C21H13Br2NOS — CID 129086159
N-[2-(1-benzothiophen-2-yl)phenyl]-3,5-dibromobenzamide (PubChem CID 129086159) has the molecular formula C21H13Br2NOS and a molecular weight of 487.22 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-2-yl)phenyl]-3,5-dibromobenzamide.
| Compound Name | N-[2-(1-benzothiophen-2-yl)phenyl]-3,5-dibromobenzamide |
|---|---|
| PubChem CID | 129086159 |
| Molecular Formula | C21H13Br2NOS |
| Molecular Weight | 487.22 g/mol |
| Exact Mass | 484.91 |
| IUPAC Name | N-[2-(1-benzothiophen-2-yl)phenyl]-3,5-dibromobenzamide |
| SMILES | O=C(Nc1ccccc1-c1cc2ccccc2s1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C21H13Br2NOS/c22-15-9-14(10-16(23)12-15)21(25)24-18-7-3-2-6-17(18)20-11-13-5-1-4-8-19(13)26-20/h1-12H,(H,24,25) |
| InChIKey | XVWYMQCFHMYVRT-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.22 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |