C18H23ClN4O3 — CID 129087164
N-(4-chloro-3-methylphenyl)-4-[2-(dimethylamino)ethoxy]-6-ethoxypyrimidine-5-carboxamide (PubChem CID 129087164) has the molecular formula C18H23ClN4O3 and a molecular weight of 378.86 g/mol. Its IUPAC name is N-(4-chloro-3-methylphenyl)-4-[2-(dimethylamino)ethoxy]-6-ethoxypyrimidine-5-carboxamide.
| Compound Name | N-(4-chloro-3-methylphenyl)-4-[2-(dimethylamino)ethoxy]-6-ethoxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 129087164 |
| Molecular Formula | C18H23ClN4O3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-(4-chloro-3-methylphenyl)-4-[2-(dimethylamino)ethoxy]-6-ethoxypyrimidine-5-carboxamide |
| SMILES | CCOc1ncnc(OCCN(C)C)c1C(=O)Nc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C18H23ClN4O3/c1-5-25-17-15(18(21-11-20-17)26-9-8-23(3)4)16(24)22-13-6-7-14(19)12(2)10-13/h6-7,10-11H,5,8-9H2,1-4H3,(H,22,24) |
| InChIKey | SORKJRWXXSLZRL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |