C20H36O14 — CID 129088809
[(3S,4R,6S)-3,4,5,6-tetrahydroxy-6-[(2S,5S)-3,4,5-trihydroxy-6-(2-hydroxyethyl)oxan-2-yl]oxyoxan-2-yl]methyl 2-ethyl-3-hydroxypentanoate (PubChem CID 129088809) has the molecular formula C20H36O14 and a molecular weight of 500.49 g/mol. Its IUPAC name is [(3S,4R,6S)-3,4,5,6-tetrahydroxy-6-[(2S,5S)-3,4,5-trihydroxy-6-(2-hydroxyethyl)oxan-2-yl]oxyoxan-2-yl]methyl 2-ethyl-3-hydroxypentanoate.
| Compound Name | [(3S,4R,6S)-3,4,5,6-tetrahydroxy-6-[(2S,5S)-3,4,5-trihydroxy-6-(2-hydroxyethyl)oxan-2-yl]oxyoxan-2-yl]methyl 2-ethyl-3-hydroxypentanoate |
|---|---|
| PubChem CID | 129088809 |
| Molecular Formula | C20H36O14 |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | [(3S,4R,6S)-3,4,5,6-tetrahydroxy-6-[(2S,5S)-3,4,5-trihydroxy-6-(2-hydroxyethyl)oxan-2-yl]oxyoxan-2-yl]methyl 2-ethyl-3-hydroxypentanoate |
| SMILES | CCC(O)C(CC)C(=O)OCC1O[C@](O)(O[C@@H]2OC(CCO)[C@@H](O)C(O)C2O)C(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H36O14/c1-3-8(9(22)4-2)18(29)31-7-11-13(24)15(26)17(28)20(30,33-11)34-19-16(27)14(25)12(23)10(32-19)5-6-21/h8-17,19,21-28,30H,3-7H2,1-2H3/t8?,9?,10?,11?,12-,13-,14?,15-,16?,17?,19+,20+/m1/s1 |
| InChIKey | NTJNWBJHCHCOPD-QHOHOXHMSA-N |
| XLogP | -4.34 |
| TPSA | 236.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|