C26H46O15 — CID 59281076
[(3R,4S,6S)-6-[(2S,4S,5R)-6-[(2-ethyl-3-hydroxypentanoyl)oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2-ethyl-3-hydroxypentanoate (PubChem CID 59281076) has the molecular formula C26H46O15 and a molecular weight of 598.64 g/mol. Its IUPAC name is [(3R,4S,6S)-6-[(2S,4S,5R)-6-[(2-ethyl-3-hydroxypentanoyl)oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2-ethyl-3-hydroxypentanoate.
| Compound Name | [(3R,4S,6S)-6-[(2S,4S,5R)-6-[(2-ethyl-3-hydroxypentanoyl)oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2-ethyl-3-hydroxypentanoate |
|---|---|
| PubChem CID | 59281076 |
| Molecular Formula | C26H46O15 |
| Molecular Weight | 598.64 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | [(3R,4S,6S)-6-[(2S,4S,5R)-6-[(2-ethyl-3-hydroxypentanoyl)oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 2-ethyl-3-hydroxypentanoate |
| SMILES | CCC(O)C(CC)C(=O)OCC1O[C@@H](O[C@@H]2OC(COC(=O)C(CC)C(O)CC)[C@H](O)[C@H](O)C2O)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H46O15/c1-5-11(13(27)7-3)23(35)37-9-15-17(29)19(31)21(33)25(39-15)41-26-22(34)20(32)18(30)16(40-26)10-38-24(36)12(6-2)14(28)8-4/h11-22,25-34H,5-10H2,1-4H3/t11?,12?,13?,14?,15?,16?,17-,18-,19-,20-,21?,22?,25-,26-/m0/s1 |
| InChIKey | ULGUGUZHBIXJNM-BLWJYPHYSA-N |
| XLogP | -2.70 |
| TPSA | 242.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.64 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |