C23H22Cl2F3N5O3S — CID 129090845
2-[[[(Z)-3-chloro-4-ethenylimino-2-methyl-4-morpholin-4-ylbut-2-enoyl]amino]methyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 129090845) has the molecular formula C23H22Cl2F3N5O3S and a molecular weight of 576.43 g/mol. Its IUPAC name is 2-[[[(Z)-3-chloro-4-ethenylimino-2-methyl-4-morpholin-4-ylbut-2-enoyl]amino]methyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[[(Z)-3-chloro-4-ethenylimino-2-methyl-4-morpholin-4-ylbut-2-enoyl]amino]methyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 129090845 |
| Molecular Formula | C23H22Cl2F3N5O3S |
| Molecular Weight | 576.43 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | 2-[[[(Z)-3-chloro-4-ethenylimino-2-methyl-4-morpholin-4-ylbut-2-enoyl]amino]methyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | C=C/N=C(C(/Cl)=C(\C)C(=O)NCc1ncc(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)s1)\N1CCOCC1 |
| InChI | InChI=1S/C23H22Cl2F3N5O3S/c1-3-29-20(33-6-8-36-9-7-33)19(25)13(2)21(34)31-12-18-30-11-17(37-18)22(35)32-14-4-5-16(24)15(10-14)23(26,27)28/h3-5,10-11H,1,6-9,12H2,2H3,(H,31,34)(H,32,35)/b19-13-,29-20- |
| InChIKey | XWZGELLQWPAYHT-AAYCRPLTSA-N |
| XLogP | 5.07 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|