C26H23Cl2F3N6O2S — CID 129091173
2-[[[(Z)-3-chloro-4-(ethenylamino)-2-methyl-4-(2-pyridin-4-ylethylimino)but-2-enoyl]amino]methyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 129091173) has the molecular formula C26H23Cl2F3N6O2S and a molecular weight of 611.48 g/mol. Its IUPAC name is 2-[[[(Z)-3-chloro-4-(ethenylamino)-2-methyl-4-(2-pyridin-4-ylethylimino)but-2-enoyl]amino]methyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[[(Z)-3-chloro-4-(ethenylamino)-2-methyl-4-(2-pyridin-4-ylethylimino)but-2-enoyl]amino]methyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 129091173 |
| Molecular Formula | C26H23Cl2F3N6O2S |
| Molecular Weight | 611.48 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | 2-[[[(Z)-3-chloro-4-(ethenylamino)-2-methyl-4-(2-pyridin-4-ylethylimino)but-2-enoyl]amino]methyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | C=CNC(=N\CCc1ccncc1)/C(Cl)=C(\C)C(=O)NCc1ncc(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C26H23Cl2F3N6O2S/c1-3-33-23(34-11-8-16-6-9-32-10-7-16)22(28)15(2)24(38)36-14-21-35-13-20(40-21)25(39)37-17-4-5-19(27)18(12-17)26(29,30)31/h3-7,9-10,12-13H,1,8,11,14H2,2H3,(H,33,34)(H,36,38)(H,37,39)/b22-15- |
| InChIKey | BAZMBOCWXBQHMG-JCMHNJIXSA-N |
| XLogP | 5.97 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|