C20H26O3P+ — CID 129091629
3-tert-butyl-4-(2,6-dimethoxyphenyl)-3-methyl-2H-1,3-benzoxaphosphol-3-ium (PubChem CID 129091629) has the molecular formula C20H26O3P+ and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-tert-butyl-4-(2,6-dimethoxyphenyl)-3-methyl-2H-1,3-benzoxaphosphol-3-ium.
| Compound Name | 3-tert-butyl-4-(2,6-dimethoxyphenyl)-3-methyl-2H-1,3-benzoxaphosphol-3-ium |
|---|---|
| PubChem CID | 129091629 |
| Molecular Formula | C20H26O3P+ |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-tert-butyl-4-(2,6-dimethoxyphenyl)-3-methyl-2H-1,3-benzoxaphosphol-3-ium |
| SMILES | COc1cccc(OC)c1-c1cccc2c1[P+](C)(C(C)(C)C)CO2 |
| InChI | InChI=1S/C20H26O3P/c1-20(2,3)24(6)13-23-17-12-7-9-14(19(17)24)18-15(21-4)10-8-11-16(18)22-5/h7-12H,13H2,1-6H3/q+1 |
| InChIKey | UQKFIFYHXCGSOB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|