C11H8N2O3 — CID 12909287
4H-imidazo[2,1-c][1,4]benzoxazine-1-carboxylic acid (PubChem CID 12909287) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 4H-imidazo[2,1-c][1,4]benzoxazine-1-carboxylic acid.
| Compound Name | 4H-imidazo[2,1-c][1,4]benzoxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 12909287 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4H-imidazo[2,1-c][1,4]benzoxazine-1-carboxylic acid |
| SMILES | O=C(O)c1cnc2n1-c1ccccc1OC2 |
| InChI | InChI=1S/C11H8N2O3/c14-11(15)8-5-12-10-6-16-9-4-2-1-3-7(9)13(8)10/h1-5H,6H2,(H,14,15) |
| InChIKey | QPNHPKIMMDOABN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |