C21H31N3O5 — CID 129094098
5-tert-butyl-9-(3-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylic acid (PubChem CID 129094098) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is 5-tert-butyl-9-(3-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylic acid.
| Compound Name | 5-tert-butyl-9-(3-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylic acid |
|---|---|
| PubChem CID | 129094098 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 5-tert-butyl-9-(3-methoxy-4-nitrophenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylic acid |
| SMILES | COc1cc(N2CCC3(CCN(C(=O)O)CC3C(C)(C)C)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H31N3O5/c1-20(2,3)18-14-23(19(25)26)12-9-21(18)7-10-22(11-8-21)15-5-6-16(24(27)28)17(13-15)29-4/h5-6,13,18H,7-12,14H2,1-4H3,(H,25,26) |
| InChIKey | WDXGNZVVGOIIHB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|