C23H34INO7 — CID 129095709
2-methylpropyl (2S)-3-[2-iodo-5-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 129095709) has the molecular formula C23H34INO7 and a molecular weight of 563.43 g/mol. Its IUPAC name is 2-methylpropyl (2S)-3-[2-iodo-5-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | 2-methylpropyl (2S)-3-[2-iodo-5-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 129095709 |
| Molecular Formula | C23H34INO7 |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 2-methylpropyl (2S)-3-[2-iodo-5-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)COC(=O)[C@H](Cc1cc(OC(=O)OC(C)(C)C)ccc1I)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34INO7/c1-14(2)13-29-19(26)18(25-20(27)31-22(3,4)5)12-15-11-16(9-10-17(15)24)30-21(28)32-23(6,7)8/h9-11,14,18H,12-13H2,1-8H3,(H,25,27)/t18-/m0/s1 |
| InChIKey | VLCILOACSLFOES-SFHVURJKSA-N |
| XLogP | 5.24 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|