C15H23NO5 — CID 129100034
(2S,3S)-2-amino-3-methoxy-3-[[(4S)-4-methyl-2-phenyl-1,3-dioxan-5-yl]oxy]propan-1-ol (PubChem CID 129100034) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methoxy-3-[[(4S)-4-methyl-2-phenyl-1,3-dioxan-5-yl]oxy]propan-1-ol.
| Compound Name | (2S,3S)-2-amino-3-methoxy-3-[[(4S)-4-methyl-2-phenyl-1,3-dioxan-5-yl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 129100034 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (2S,3S)-2-amino-3-methoxy-3-[[(4S)-4-methyl-2-phenyl-1,3-dioxan-5-yl]oxy]propan-1-ol |
| SMILES | CO[C@@H](OC1COC(c2ccccc2)O[C@H]1C)[C@@H](N)CO |
| InChI | InChI=1S/C15H23NO5/c1-10-13(21-15(18-2)12(16)8-17)9-19-14(20-10)11-6-4-3-5-7-11/h3-7,10,12-15,17H,8-9,16H2,1-2H3/t10-,12-,13?,14?,15-/m0/s1 |
| InChIKey | NUNFACFMRUQWTQ-GUUWLEBZSA-N |
| XLogP | 0.80 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|