C15H23I — CID 129101543
(3E,5E,7E,9E)-2-iodo-2,11,11-trimethyldodeca-3,5,7,9-tetraene (PubChem CID 129101543) has the molecular formula C15H23I and a molecular weight of 330.25 g/mol. Its IUPAC name is (3E,5E,7E,9E)-2-iodo-2,11,11-trimethyldodeca-3,5,7,9-tetraene.
| Compound Name | (3E,5E,7E,9E)-2-iodo-2,11,11-trimethyldodeca-3,5,7,9-tetraene |
|---|---|
| PubChem CID | 129101543 |
| Molecular Formula | C15H23I |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (3E,5E,7E,9E)-2-iodo-2,11,11-trimethyldodeca-3,5,7,9-tetraene |
| SMILES | CC(C)(C)/C=C/C=C/C=C/C=C/C(C)(C)I |
| InChI | InChI=1S/C15H23I/c1-14(2,3)12-10-8-6-7-9-11-13-15(4,5)16/h6-13H,1-5H3/b8-6+,9-7+,12-10+,13-11+ |
| InChIKey | QBVNTCPLKWEENV-LZBUJHLNSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|