C28H32F6O8S — CID 129102840
3-(1-adamantylmethoxycarbonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]oxycarbonylbenzenesulfonic acid (PubChem CID 129102840) has the molecular formula C28H32F6O8S and a molecular weight of 642.61 g/mol. Its IUPAC name is 3-(1-adamantylmethoxycarbonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]oxycarbonylbenzenesulfonic acid.
| Compound Name | 3-(1-adamantylmethoxycarbonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]oxycarbonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 129102840 |
| Molecular Formula | C28H32F6O8S |
| Molecular Weight | 642.61 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | 3-(1-adamantylmethoxycarbonyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]oxycarbonylbenzenesulfonic acid |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)c1cc(C(=O)OC2CCC(C(O)(C(F)(F)F)C(F)(F)F)CC2)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C28H32F6O8S/c29-27(30,31)26(37,28(32,33)34)20-1-3-21(4-2-20)42-24(36)19-8-18(9-22(10-19)43(38,39)40)23(35)41-14-25-11-15-5-16(12-25)7-17(6-15)13-25/h8-10,15-17,20-21,37H,1-7,11-14H2,(H,38,39,40) |
| InChIKey | GHHYCYXJLZNUMY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|