C12H19FN2 — CID 129102967
(1E,4E)-2-fluoro-4-propan-2-yl-1-N-propan-2-ylidenehexa-1,4-diene-1,3-diimine (PubChem CID 129102967) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is (1E,4E)-2-fluoro-4-propan-2-yl-1-N-propan-2-ylidenehexa-1,4-diene-1,3-diimine.
| Compound Name | (1E,4E)-2-fluoro-4-propan-2-yl-1-N-propan-2-ylidenehexa-1,4-diene-1,3-diimine |
|---|---|
| PubChem CID | 129102967 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | (1E,4E)-2-fluoro-4-propan-2-yl-1-N-propan-2-ylidenehexa-1,4-diene-1,3-diimine |
| SMILES | [H]/N=C(C(\F)=C/N=C(C)C)/C(=C/C)C(C)C |
| InChI | InChI=1S/C12H19FN2/c1-6-10(8(2)3)12(14)11(13)7-15-9(4)5/h6-8,14H,1-5H3/b10-6+,11-7+,14-12- |
| InChIKey | HPQIPVDGUIEYJW-RVCVQGHKSA-N |
| XLogP | 3.90 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|