C11H20N2O6 — CID 129103477
[(2R,4R,6R)-6-[(3R,5S)-5-aminooxan-3-yl]oxy-4-nitrooxan-2-yl]methanol (PubChem CID 129103477) has the molecular formula C11H20N2O6 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(2R,4R,6R)-6-[(3R,5S)-5-aminooxan-3-yl]oxy-4-nitrooxan-2-yl]methanol.
| Compound Name | [(2R,4R,6R)-6-[(3R,5S)-5-aminooxan-3-yl]oxy-4-nitrooxan-2-yl]methanol |
|---|---|
| PubChem CID | 129103477 |
| Molecular Formula | C11H20N2O6 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [(2R,4R,6R)-6-[(3R,5S)-5-aminooxan-3-yl]oxy-4-nitrooxan-2-yl]methanol |
| SMILES | N[C@@H]1COC[C@H](O[C@@H]2C[C@H]([N+](=O)[O-])C[C@H](CO)O2)C1 |
| InChI | InChI=1S/C11H20N2O6/c12-7-1-10(6-17-5-7)19-11-3-8(13(15)16)2-9(4-14)18-11/h7-11,14H,1-6,12H2/t7-,8+,9+,10+,11+/m0/s1 |
| InChIKey | VLMJDMFRLXYHPS-VPJKUYQRSA-N |
| XLogP | -0.74 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|