About 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol
2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol (PubChem CID 170910390) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol.
Analyze 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol?
The IUPAC name of 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol (CID 170910390) is 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol.
What is the SMILES notation for 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol?
The canonical SMILES for 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol is OCC1CC2COCC2O1.
What is the InChIKey of 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol?
The InChIKey is WTDVBZZHXIWTEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c8-2-6-1-5-3-9-4-7(5)10-6/h5-8H,1-4H2.
What are the key properties of 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol?
2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol has a molecular weight of 144.17 g/mol, XLogP of -0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-ylmethanol is sourced from PubChem (CID 170910390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).