About methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate
methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate (PubChem CID 129104085) has the molecular formula C9H9N3O2S
and a molecular weight of 223.26 g/mol. Its IUPAC name is methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate.
Analyze methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate?
The IUPAC name of methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate (CID 129104085) is methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate.
What is the SMILES notation for methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate?
The canonical SMILES for methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate is COC(=O)C1=CN(c2nccs2)C=NC1.
What is the InChIKey of methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate?
The InChIKey is JGQXJZUVLOSPMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2S/c1-14-8(13)7-4-10-6-12(5-7)9-11-2-3-15-9/h2-3,5-6H,4H2,1H3.
What are the key properties of methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate?
methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate has a molecular weight of 223.26 g/mol, XLogP of 1.05, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(1,3-thiazol-2-yl)-4H-pyrimidine-5-carboxylate is sourced from PubChem (CID 129104085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).