C22H25ClN6O4 — CID 129113432
1-(3-aminooxypropyl)-7-[(5-chloro-2-pyridinyl)methyl]-3-methyl-8-(2-methylcyclohexa-1,3-dien-1-yl)oxypurine-2,6-dione (PubChem CID 129113432) has the molecular formula C22H25ClN6O4 and a molecular weight of 472.93 g/mol. Its IUPAC name is 1-(3-aminooxypropyl)-7-[(5-chloro-2-pyridinyl)methyl]-3-methyl-8-(2-methylcyclohexa-1,3-dien-1-yl)oxypurine-2,6-dione.
| Compound Name | 1-(3-aminooxypropyl)-7-[(5-chloro-2-pyridinyl)methyl]-3-methyl-8-(2-methylcyclohexa-1,3-dien-1-yl)oxypurine-2,6-dione |
|---|---|
| PubChem CID | 129113432 |
| Molecular Formula | C22H25ClN6O4 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 1-(3-aminooxypropyl)-7-[(5-chloro-2-pyridinyl)methyl]-3-methyl-8-(2-methylcyclohexa-1,3-dien-1-yl)oxypurine-2,6-dione |
| SMILES | CC1=C(Oc2nc3c(c(=O)n(CCCON)c(=O)n3C)n2Cc2ccc(Cl)cn2)CCC=C1 |
| InChI | InChI=1S/C22H25ClN6O4/c1-14-6-3-4-7-17(14)33-21-26-19-18(29(21)13-16-9-8-15(23)12-25-16)20(30)28(10-5-11-32-24)22(31)27(19)2/h3,6,8-9,12H,4-5,7,10-11,13,24H2,1-2H3 |
| InChIKey | NOKQQPWACSCQOM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|