C35H42O2P+ — CID 129118262
[(12Z)-13-methyl-11,14-dioxohexadeca-12,15-dienyl]-triphenylphosphanium (PubChem CID 129118262) has the molecular formula C35H42O2P+ and a molecular weight of 525.69 g/mol. Its IUPAC name is [(12Z)-13-methyl-11,14-dioxohexadeca-12,15-dienyl]-triphenylphosphanium.
| Compound Name | [(12Z)-13-methyl-11,14-dioxohexadeca-12,15-dienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 129118262 |
| Molecular Formula | C35H42O2P+ |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | [(12Z)-13-methyl-11,14-dioxohexadeca-12,15-dienyl]-triphenylphosphanium |
| SMILES | C=CC(=O)/C(C)=C\C(=O)CCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H42O2P/c1-3-35(37)30(2)29-31(36)21-13-8-6-4-5-7-9-20-28-38(32-22-14-10-15-23-32,33-24-16-11-17-25-33)34-26-18-12-19-27-34/h3,10-12,14-19,22-27,29H,1,4-9,13,20-21,28H2,2H3/q+1/b30-29- |
| InChIKey | AYTIQZKZZHZJST-FLWNBWAVSA-N |
| XLogP | 7.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|