C31H29Cl6NO7P+ — CID 86582947
[6-oxo-6-[tris[(2,2-dichloroacetyl)oxy]methylamino]hexyl]-triphenylphosphanium (PubChem CID 86582947) has the molecular formula C31H29Cl6NO7P+ and a molecular weight of 771.27 g/mol. Its IUPAC name is [6-oxo-6-[tris[(2,2-dichloroacetyl)oxy]methylamino]hexyl]-triphenylphosphanium.
| Compound Name | [6-oxo-6-[tris[(2,2-dichloroacetyl)oxy]methylamino]hexyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 86582947 |
| Molecular Formula | C31H29Cl6NO7P+ |
| Molecular Weight | 771.27 g/mol |
| Exact Mass | 767.98 |
| IUPAC Name | [6-oxo-6-[tris[(2,2-dichloroacetyl)oxy]methylamino]hexyl]-triphenylphosphanium |
| SMILES | O=C(CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(OC(=O)C(Cl)Cl)(OC(=O)C(Cl)Cl)OC(=O)C(Cl)Cl |
| InChI | InChI=1S/C31H28Cl6NO7P/c32-25(33)28(40)43-31(44-29(41)26(34)35,45-30(42)27(36)37)38-24(39)19-11-4-12-20-46(21-13-5-1-6-14-21,22-15-7-2-8-16-22)23-17-9-3-10-18-23/h1-3,5-10,13-18,25-27H,4,11-12,19-20H2/p+1 |
| InChIKey | NKQOWIKUTZAYLB-UHFFFAOYSA-O |
| XLogP | 6.31 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.27 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|