C31H28Cl6NO7P — CID 86582946
(1Z)-6-triphenylphosphaniumyl-N-[tris[(2,2-dichloroacetyl)oxy]methyl]hexanimidate (PubChem CID 86582946) has the molecular formula C31H28Cl6NO7P and a molecular weight of 770.26 g/mol. Its IUPAC name is (1Z)-6-triphenylphosphaniumyl-N-[tris[(2,2-dichloroacetyl)oxy]methyl]hexanimidate.
| Compound Name | (1Z)-6-triphenylphosphaniumyl-N-[tris[(2,2-dichloroacetyl)oxy]methyl]hexanimidate |
|---|---|
| PubChem CID | 86582946 |
| Molecular Formula | C31H28Cl6NO7P |
| Molecular Weight | 770.26 g/mol |
| Exact Mass | 766.97 |
| IUPAC Name | (1Z)-6-triphenylphosphaniumyl-N-[tris[(2,2-dichloroacetyl)oxy]methyl]hexanimidate |
| SMILES | O=C(OC(/N=C(\[O-])CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)(OC(=O)C(Cl)Cl)OC(=O)C(Cl)Cl)C(Cl)Cl |
| InChI | InChI=1S/C31H28Cl6NO7P/c32-25(33)28(40)43-31(44-29(41)26(34)35,45-30(42)27(36)37)38-24(39)19-11-4-12-20-46(21-13-5-1-6-14-21,22-15-7-2-8-16-22)23-17-9-3-10-18-23/h1-3,5-10,13-18,25-27H,4,11-12,19-20H2 |
| InChIKey | NKQOWIKUTZAYLB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 114.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.26 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|