C29H47F9O5 — CID 129118808
[3,3-diethyl-7,7,7-trifluoro-6-hydroxy-5,5,6-trimethyl-2-[3-[4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl]oxypentan-3-yl]heptyl] 2-methylprop-2-enoate (PubChem CID 129118808) has the molecular formula C29H47F9O5 and a molecular weight of 646.67 g/mol. Its IUPAC name is [3,3-diethyl-7,7,7-trifluoro-6-hydroxy-5,5,6-trimethyl-2-[3-[4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl]oxypentan-3-yl]heptyl] 2-methylprop-2-enoate.
| Compound Name | [3,3-diethyl-7,7,7-trifluoro-6-hydroxy-5,5,6-trimethyl-2-[3-[4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl]oxypentan-3-yl]heptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118808 |
| Molecular Formula | C29H47F9O5 |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | [3,3-diethyl-7,7,7-trifluoro-6-hydroxy-5,5,6-trimethyl-2-[3-[4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl]oxypentan-3-yl]heptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C(CC)(CC)CC(C)(C)C(C)(O)C(F)(F)F)C(CC)(CC)OC(C)(C)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H47F9O5/c1-12-24(13-2,17-21(7,8)23(11,40)27(30,31)32)19(16-42-20(39)18(5)6)25(14-3,15-4)43-22(9,10)26(41,28(33,34)35)29(36,37)38/h19,40-41H,5,12-17H2,1-4,6-11H3 |
| InChIKey | FZLGBJRMKYSHDL-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|