C19H15F6IO5 — CID 129121475
[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 6-(2-iodobutanoyloxy)naphthalene-2-carboxylate (PubChem CID 129121475) has the molecular formula C19H15F6IO5 and a molecular weight of 564.22 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 6-(2-iodobutanoyloxy)naphthalene-2-carboxylate.
| Compound Name | [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 6-(2-iodobutanoyloxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 129121475 |
| Molecular Formula | C19H15F6IO5 |
| Molecular Weight | 564.22 g/mol |
| Exact Mass | 563.99 |
| IUPAC Name | [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 6-(2-iodobutanoyloxy)naphthalene-2-carboxylate |
| SMILES | CCC(I)C(=O)Oc1ccc2cc(C(=O)OCC(O)(C(F)(F)F)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C19H15F6IO5/c1-2-14(26)16(28)31-13-6-5-10-7-12(4-3-11(10)8-13)15(27)30-9-17(29,18(20,21)22)19(23,24)25/h3-8,14,29H,2,9H2,1H3 |
| InChIKey | RBMSKYJINBOHJC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.22 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|