C16H16F6O5 — CID 147854880
[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 4-(2-methylbutanoyloxy)benzoate (PubChem CID 147854880) has the molecular formula C16H16F6O5 and a molecular weight of 402.29 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 4-(2-methylbutanoyloxy)benzoate.
| Compound Name | [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 4-(2-methylbutanoyloxy)benzoate |
|---|---|
| PubChem CID | 147854880 |
| Molecular Formula | C16H16F6O5 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 4-(2-methylbutanoyloxy)benzoate |
| SMILES | CCC(C)C(=O)Oc1ccc(C(=O)OCC(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F6O5/c1-3-9(2)12(23)27-11-6-4-10(5-7-11)13(24)26-8-14(25,15(17,18)19)16(20,21)22/h4-7,9,25H,3,8H2,1-2H3 |
| InChIKey | HVNRHANVKMUQRS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|