About 2-methylsulfinylaniline
2-methylsulfinylaniline (PubChem CID 12913076) has the molecular formula C7H9NOS
and a molecular weight of 155.22 g/mol. Its IUPAC name is 2-methylsulfinylaniline.
Molecular Properties
| Compound Name | 2-methylsulfinylaniline |
| PubChem CID | 12913076 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 2-methylsulfinylaniline |
| SMILES | CS(=O)c1ccccc1N |
| InChI | InChI=1S/C7H9NOS/c1-10(9)7-5-3-2-4-6(7)8/h2-5H,8H2,1H3 |
| InChIKey | OGUIFELBZNMXGH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfinylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfinylaniline?
The IUPAC name of 2-methylsulfinylaniline (CID 12913076) is 2-methylsulfinylaniline.
What is the SMILES notation for 2-methylsulfinylaniline?
The canonical SMILES for 2-methylsulfinylaniline is CS(=O)c1ccccc1N.
What is the InChIKey of 2-methylsulfinylaniline?
The InChIKey is OGUIFELBZNMXGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NOS/c1-10(9)7-5-3-2-4-6(7)8/h2-5H,8H2,1H3.
What are the key properties of 2-methylsulfinylaniline?
2-methylsulfinylaniline has a molecular weight of 155.22 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfinylaniline is sourced from PubChem (CID 12913076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).