C25H47N5O10 — CID 129132810
4-amino-N-[2-[[1-[2-[2-[2-[2-[[(6S)-3,4-dihydroxy-6-methoxyoxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]propan-2-yl]butanamide (PubChem CID 129132810) has the molecular formula C25H47N5O10 and a molecular weight of 577.68 g/mol. Its IUPAC name is 4-amino-N-[2-[[1-[2-[2-[2-[2-[[(6S)-3,4-dihydroxy-6-methoxyoxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]propan-2-yl]butanamide.
| Compound Name | 4-amino-N-[2-[[1-[2-[2-[2-[2-[[(6S)-3,4-dihydroxy-6-methoxyoxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]propan-2-yl]butanamide |
|---|---|
| PubChem CID | 129132810 |
| Molecular Formula | C25H47N5O10 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | 4-amino-N-[2-[[1-[2-[2-[2-[2-[[(6S)-3,4-dihydroxy-6-methoxyoxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]propan-2-yl]butanamide |
| SMILES | CO[C@@H]1CC(O)C(O)C(COCCOCCOCCOCCn2cc(COC(C)(C)NC(=O)CCCN)nn2)O1 |
| InChI | InChI=1S/C25H47N5O10/c1-25(2,27-22(32)5-4-6-26)39-17-19-16-30(29-28-19)7-8-35-9-10-36-11-12-37-13-14-38-18-21-24(33)20(31)15-23(34-3)40-21/h16,20-21,23-24,31,33H,4-15,17-18,26H2,1-3H3,(H,27,32)/t20?,21?,23-,24?/m0/s1 |
| InChIKey | KHWOGTKTOIKDSP-VYDPGFJDSA-N |
| XLogP | -1.06 |
| TPSA | 190.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|