C16H19N3O4 — CID 12913361
diethyl 2-[[(8-methylimidazo[1,2-a]pyridin-3-yl)amino]methylidene]propanedioate (PubChem CID 12913361) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is diethyl 2-[[(8-methylimidazo[1,2-a]pyridin-3-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(8-methylimidazo[1,2-a]pyridin-3-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 12913361 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | diethyl 2-[[(8-methylimidazo[1,2-a]pyridin-3-yl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cnc2c(C)cccn12)C(=O)OCC |
| InChI | InChI=1S/C16H19N3O4/c1-4-22-15(20)12(16(21)23-5-2)9-17-13-10-18-14-11(3)7-6-8-19(13)14/h6-10,17H,4-5H2,1-3H3 |
| InChIKey | MQIBCMQHEIGNHY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|