C17H19N3O5 — CID 15320945
diethyl 2-[[(2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)amino]methylidene]propanedioate (PubChem CID 15320945) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is diethyl 2-[[(2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 15320945 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | diethyl 2-[[(2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1c(C)nc2ccccn2c1=O)C(=O)OCC |
| InChI | InChI=1S/C17H19N3O5/c1-4-24-16(22)12(17(23)25-5-2)10-18-14-11(3)19-13-8-6-7-9-20(13)15(14)21/h6-10,18H,4-5H2,1-3H3 |
| InChIKey | ABMAKSMTVQUTCJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|