C29H27N3O3 — CID 129137936
2-[[2-(2-methyl-3-phenylphenyl)-6-(pyridin-2-ylmethoxy)-1,3-benzoxazol-5-yl]methylamino]ethanol (PubChem CID 129137936) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[[2-(2-methyl-3-phenylphenyl)-6-(pyridin-2-ylmethoxy)-1,3-benzoxazol-5-yl]methylamino]ethanol.
| Compound Name | 2-[[2-(2-methyl-3-phenylphenyl)-6-(pyridin-2-ylmethoxy)-1,3-benzoxazol-5-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 129137936 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[[2-(2-methyl-3-phenylphenyl)-6-(pyridin-2-ylmethoxy)-1,3-benzoxazol-5-yl]methylamino]ethanol |
| SMILES | Cc1c(-c2ccccc2)cccc1-c1nc2cc(CNCCO)c(OCc3ccccn3)cc2o1 |
| InChI | InChI=1S/C29H27N3O3/c1-20-24(21-8-3-2-4-9-21)11-7-12-25(20)29-32-26-16-22(18-30-14-15-33)27(17-28(26)35-29)34-19-23-10-5-6-13-31-23/h2-13,16-17,30,33H,14-15,18-19H2,1H3 |
| InChIKey | GEHNLXIJMMXQRC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|