C20H13Cl2F7N4O2 — CID 129138240
ethyl 5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methylpyridine-3-carboxylate (PubChem CID 129138240) has the molecular formula C20H13Cl2F7N4O2 and a molecular weight of 545.24 g/mol. Its IUPAC name is ethyl 5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methylpyridine-3-carboxylate.
| Compound Name | ethyl 5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 129138240 |
| Molecular Formula | C20H13Cl2F7N4O2 |
| Molecular Weight | 545.24 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | ethyl 5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]-2-methylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cn(-c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3Cl)nn2)cnc1C |
| InChI | InChI=1S/C20H13Cl2F7N4O2/c1-3-35-17(34)12-4-10(7-30-9(12)2)15-8-33(32-31-15)16-13(21)5-11(6-14(16)22)18(23,19(24,25)26)20(27,28)29/h4-8H,3H2,1-2H3 |
| InChIKey | NPJXPZFMDCPSPP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.24 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |