C21H15NO5 — CID 129142531
4-[2-[4-[(3-hydroxy-4-oxopyran-2-yl)methylamino]phenyl]ethynyl]benzoic acid (PubChem CID 129142531) has the molecular formula C21H15NO5 and a molecular weight of 361.35 g/mol. Its IUPAC name is 4-[2-[4-[(3-hydroxy-4-oxopyran-2-yl)methylamino]phenyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[4-[(3-hydroxy-4-oxopyran-2-yl)methylamino]phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 129142531 |
| Molecular Formula | C21H15NO5 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 4-[2-[4-[(3-hydroxy-4-oxopyran-2-yl)methylamino]phenyl]ethynyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C#Cc2ccc(NCc3occc(=O)c3O)cc2)cc1 |
| InChI | InChI=1S/C21H15NO5/c23-18-11-12-27-19(20(18)24)13-22-17-9-5-15(6-10-17)2-1-14-3-7-16(8-4-14)21(25)26/h3-12,22,24H,13H2,(H,25,26) |
| InChIKey | FKJKMZAIMJWZON-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|