C28H27N3O4 — CID 146552731
2-[[4-[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)phenyl]ethynyl]anilino]methyl]-3-hydroxypyran-4-one (PubChem CID 146552731) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-[[4-[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)phenyl]ethynyl]anilino]methyl]-3-hydroxypyran-4-one.
| Compound Name | 2-[[4-[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)phenyl]ethynyl]anilino]methyl]-3-hydroxypyran-4-one |
|---|---|
| PubChem CID | 146552731 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[[4-[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)phenyl]ethynyl]anilino]methyl]-3-hydroxypyran-4-one |
| SMILES | O=C(c1ccc(C#Cc2ccc(NCc3occc(=O)c3O)cc2)cc1)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C28H27N3O4/c32-25-13-17-35-26(27(25)33)18-29-23-11-7-21(8-12-23)4-3-20-5-9-22(10-6-20)28(34)31-16-15-30-14-1-2-24(30)19-31/h5-13,17,24,29,33H,1-2,14-16,18-19H2 |
| InChIKey | SCFSBYIXRXXNAX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|