C8H13Cl2NO — CID 12914710
N-butan-2-yl-N-(2,2-dichloroethenyl)acetamide (PubChem CID 12914710) has the molecular formula C8H13Cl2NO and a molecular weight of 210.10 g/mol. Its IUPAC name is N-butan-2-yl-N-(2,2-dichloroethenyl)acetamide.
| Compound Name | N-butan-2-yl-N-(2,2-dichloroethenyl)acetamide |
|---|---|
| PubChem CID | 12914710 |
| Molecular Formula | C8H13Cl2NO |
| Molecular Weight | 210.10 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | N-butan-2-yl-N-(2,2-dichloroethenyl)acetamide |
| SMILES | CCC(C)N(C=C(Cl)Cl)C(C)=O |
| InChI | InChI=1S/C8H13Cl2NO/c1-4-6(2)11(7(3)12)5-8(9)10/h5-6H,4H2,1-3H3 |
| InChIKey | VJMYGMAIWNIQMU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.10 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |