C35H39FN6O5 — CID 129147551
(1R,2R,4R)-N-[2-[[5-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-5-oxopentanoyl]amino]ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 129147551) has the molecular formula C35H39FN6O5 and a molecular weight of 642.73 g/mol. Its IUPAC name is (1R,2R,4R)-N-[2-[[5-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-5-oxopentanoyl]amino]ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-[2-[[5-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-5-oxopentanoyl]amino]ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 129147551 |
| Molecular Formula | C35H39FN6O5 |
| Molecular Weight | 642.73 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | (1R,2R,4R)-N-[2-[[5-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-5-oxopentanoyl]amino]ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(CCCC(=O)N1CCN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1)NCCNC(=O)[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C35H39FN6O5/c36-29-11-9-23(21-30-25-4-1-2-5-26(25)34(46)40-39-30)20-28(29)35(47)42-16-14-41(15-17-42)32(44)7-3-6-31(43)37-12-13-38-33(45)27-19-22-8-10-24(27)18-22/h1-2,4-5,8-11,20,22,24,27H,3,6-7,12-19,21H2,(H,37,43)(H,38,45)(H,40,46)/t22-,24+,27-/m1/s1 |
| InChIKey | KOALEVRTHSOXTL-RWCIVJTCSA-N |
| XLogP | 2.55 |
| TPSA | 144.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|