C22H40N6O5 — CID 129148354
4-[3-[3-[[2-[2-[(4-methyl-(1,4-15N2)1,4-diazinan-1-yl)methyl](115N)azolidin-1-yl]acetyl]amino](1,2,3-13C3)propanoylamino](1,2,3-13C3)propanoylamino](1,2,3,4-13C4)butanoic acid (PubChem CID 129148354) has the molecular formula C22H40N6O5 and a molecular weight of 482.49 g/mol. Its IUPAC name is 4-[3-[3-[[2-[2-[(4-methyl-(1,4-15N2)1,4-diazinan-1-yl)methyl](115N)azolidin-1-yl]acetyl]amino](1,2,3-13C3)propanoylamino](1,2,3-13C3)propanoylamino](1,2,3,4-13C4)butanoic acid.
| Compound Name | 4-[3-[3-[[2-[2-[(4-methyl-(1,4-15N2)1,4-diazinan-1-yl)methyl](115N)azolidin-1-yl]acetyl]amino](1,2,3-13C3)propanoylamino](1,2,3-13C3)propanoylamino](1,2,3,4-13C4)butanoic acid |
|---|---|
| PubChem CID | 129148354 |
| Molecular Formula | C22H40N6O5 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | 4-[3-[3-[[2-[2-[(4-methyl-(1,4-15N2)1,4-diazinan-1-yl)methyl](115N)azolidin-1-yl]acetyl]amino](1,2,3-13C3)propanoylamino](1,2,3-13C3)propanoylamino](1,2,3,4-13C4)butanoic acid |
| SMILES | C[15N]1CC[15N](CC2CCC[15N]2C[13C](=O)N[13CH2][13CH2][13C](=O)N[13CH2][13CH2][13C](=O)N[13CH2][13CH2][13CH2][13C](=O)O)CC1 |
| InChI | InChI=1S/C22H40N6O5/c1-26-12-14-27(15-13-26)16-18-4-3-11-28(18)17-21(31)25-10-7-20(30)24-9-6-19(29)23-8-2-5-22(32)33/h18H,2-17H2,1H3,(H,23,29)(H,24,30)(H,25,31)(H,32,33)/i2+1,5+1,6+1,7+1,8+1,9+1,10+1,19+1,20+1,21+1,22+1,26+1,27+1,28+1 |
| InChIKey | UEQQHPISJSRXDJ-KXFGGRSSSA-N |
| XLogP | -1.31 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|