C20H37N5O4 — CID 129148530
4-[4-[[2-[2-[(4-methyl-(115N)1,4-diazinan-1-yl)(113C)methyl](115N)azolidin-1-yl]acetyl]amino](1,2,3,4-13C4)butanoyl(15N)amino](1,2,3,4-13C4)butanoic acid (PubChem CID 129148530) has the molecular formula C20H37N5O4 and a molecular weight of 423.46 g/mol. Its IUPAC name is 4-[4-[[2-[2-[(4-methyl-(115N)1,4-diazinan-1-yl)(113C)methyl](115N)azolidin-1-yl]acetyl]amino](1,2,3,4-13C4)butanoyl(15N)amino](1,2,3,4-13C4)butanoic acid.
| Compound Name | 4-[4-[[2-[2-[(4-methyl-(115N)1,4-diazinan-1-yl)(113C)methyl](115N)azolidin-1-yl]acetyl]amino](1,2,3,4-13C4)butanoyl(15N)amino](1,2,3,4-13C4)butanoic acid |
|---|---|
| PubChem CID | 129148530 |
| Molecular Formula | C20H37N5O4 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | 4-[4-[[2-[2-[(4-methyl-(115N)1,4-diazinan-1-yl)(113C)methyl](115N)azolidin-1-yl]acetyl]amino](1,2,3,4-13C4)butanoyl(15N)amino](1,2,3,4-13C4)butanoic acid |
| SMILES | CN1CC[15N]([13CH2]C2CCC[15N]2CC(=O)N[13CH2][13CH2][13CH2][13C](=O)[15NH][13CH2][13CH2][13CH2][13C](=O)O)CC1 |
| InChI | InChI=1S/C20H37N5O4/c1-23-11-13-24(14-12-23)15-17-5-4-10-25(17)16-19(27)22-8-2-6-18(26)21-9-3-7-20(28)29/h17H,2-16H2,1H3,(H,21,26)(H,22,27)(H,28,29)/i2+1,3+1,6+1,7+1,8+1,9+1,15+1,18+1,20+1,21+1,24+1,25+1 |
| InChIKey | KKVRBWPRUJGERS-ONLMOTAPSA-N |
| XLogP | -0.42 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|