C21H39N5O4 — CID 129148571
4-[4-[[2-[2-[(4-ethyl-(115N)1,4-diazinan-1-yl)(113C)methyl](2,3,4,5-13C4,115N)azolidin-1-yl]acetyl]amino](213C)butanoylamino](213C)butanoic acid (PubChem CID 129148571) has the molecular formula C21H39N5O4 and a molecular weight of 436.49 g/mol. Its IUPAC name is 4-[4-[[2-[2-[(4-ethyl-(115N)1,4-diazinan-1-yl)(113C)methyl](2,3,4,5-13C4,115N)azolidin-1-yl]acetyl]amino](213C)butanoylamino](213C)butanoic acid.
| Compound Name | 4-[4-[[2-[2-[(4-ethyl-(115N)1,4-diazinan-1-yl)(113C)methyl](2,3,4,5-13C4,115N)azolidin-1-yl]acetyl]amino](213C)butanoylamino](213C)butanoic acid |
|---|---|
| PubChem CID | 129148571 |
| Molecular Formula | C21H39N5O4 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 4-[4-[[2-[2-[(4-ethyl-(115N)1,4-diazinan-1-yl)(113C)methyl](2,3,4,5-13C4,115N)azolidin-1-yl]acetyl]amino](213C)butanoylamino](213C)butanoic acid |
| SMILES | CCN1CC[15N]([13CH2][13CH]2[13CH2][13CH2][13CH2][15N]2[13CH2][13C](=O)NCC[13CH2]C(=O)NCC[13CH2]C(=O)O)CC1 |
| InChI | InChI=1S/C21H39N5O4/c1-2-24-12-14-25(15-13-24)16-18-6-5-11-26(18)17-20(28)23-9-3-7-19(27)22-10-4-8-21(29)30/h18H,2-17H2,1H3,(H,22,27)(H,23,28)(H,29,30)/i5+1,6+1,7+1,8+1,11+1,16+1,17+1,18+1,20+1,25+1,26+1 |
| InChIKey | IJAJNFQZANTDQA-VRUUYEOTSA-N |
| XLogP | -0.03 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|