C20H37N5O4 — CID 129148621
4-[4-[[2-[2-[(4-methyl-(2,3,5,6-13C4)1,4-diazinan-1-yl)(113C)methyl](2,3,4,5-13C4)azolidin-1-yl]acetyl]amino](413C)butanoylamino]butanoic acid (PubChem CID 129148621) has the molecular formula C20H37N5O4 and a molecular weight of 421.47 g/mol. Its IUPAC name is 4-[4-[[2-[2-[(4-methyl-(2,3,5,6-13C4)1,4-diazinan-1-yl)(113C)methyl](2,3,4,5-13C4)azolidin-1-yl]acetyl]amino](413C)butanoylamino]butanoic acid.
| Compound Name | 4-[4-[[2-[2-[(4-methyl-(2,3,5,6-13C4)1,4-diazinan-1-yl)(113C)methyl](2,3,4,5-13C4)azolidin-1-yl]acetyl]amino](413C)butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 129148621 |
| Molecular Formula | C20H37N5O4 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | 4-[4-[[2-[2-[(4-methyl-(2,3,5,6-13C4)1,4-diazinan-1-yl)(113C)methyl](2,3,4,5-13C4)azolidin-1-yl]acetyl]amino](413C)butanoylamino]butanoic acid |
| SMILES | CN1[13CH2][13CH2]N([13CH2][13CH]2[13CH2][13CH2][13CH2]N2CC(=O)N[13CH2]CCC(=O)NCCCC(=O)O)[13CH2][13CH2]1 |
| InChI | InChI=1S/C20H37N5O4/c1-23-11-13-24(14-12-23)15-17-5-4-10-25(17)16-19(27)22-8-2-6-18(26)21-9-3-7-20(28)29/h17H,2-16H2,1H3,(H,21,26)(H,22,27)(H,28,29)/i4+1,5+1,8+1,10+1,11+1,12+1,13+1,14+1,15+1,17+1 |
| InChIKey | KKVRBWPRUJGERS-BYBCBIDUSA-N |
| XLogP | -0.42 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|