C17H18N6OS — CID 129156581
3-(1,3-benzothiazol-6-ylamino)-5-piperidin-1-ylpyrazine-2-carboxamide (PubChem CID 129156581) has the molecular formula C17H18N6OS and a molecular weight of 354.44 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-ylamino)-5-piperidin-1-ylpyrazine-2-carboxamide.
| Compound Name | 3-(1,3-benzothiazol-6-ylamino)-5-piperidin-1-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 129156581 |
| Molecular Formula | C17H18N6OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 3-(1,3-benzothiazol-6-ylamino)-5-piperidin-1-ylpyrazine-2-carboxamide |
| SMILES | NC(=O)c1ncc(N2CCCCC2)nc1Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C17H18N6OS/c18-16(24)15-17(21-11-4-5-12-13(8-11)25-10-20-12)22-14(9-19-15)23-6-2-1-3-7-23/h4-5,8-10H,1-3,6-7H2,(H2,18,24)(H,21,22) |
| InChIKey | NUJMGXNXCUPOIX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |