C21H27FN6O — CID 138516087
3-(2-fluoro-4-piperidin-4-ylanilino)-5-piperidin-1-ylpyrazine-2-carboxamide (PubChem CID 138516087) has the molecular formula C21H27FN6O and a molecular weight of 398.49 g/mol. Its IUPAC name is 3-(2-fluoro-4-piperidin-4-ylanilino)-5-piperidin-1-ylpyrazine-2-carboxamide.
| Compound Name | 3-(2-fluoro-4-piperidin-4-ylanilino)-5-piperidin-1-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 138516087 |
| Molecular Formula | C21H27FN6O |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3-(2-fluoro-4-piperidin-4-ylanilino)-5-piperidin-1-ylpyrazine-2-carboxamide |
| SMILES | NC(=O)c1ncc(N2CCCCC2)nc1Nc1ccc(C2CCNCC2)cc1F |
| InChI | InChI=1S/C21H27FN6O/c22-16-12-15(14-6-8-24-9-7-14)4-5-17(16)26-21-19(20(23)29)25-13-18(27-21)28-10-2-1-3-11-28/h4-5,12-14,24H,1-3,6-11H2,(H2,23,29)(H,26,27) |
| InChIKey | ZVZXKMMVTPVFEO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |