C20H20F3N7O — CID 146558901
3-(4-piperidin-4-ylanilino)-5-[3-(trifluoromethyl)pyrazol-1-yl]pyrazine-2-carboxamide (PubChem CID 146558901) has the molecular formula C20H20F3N7O and a molecular weight of 431.42 g/mol. Its IUPAC name is 3-(4-piperidin-4-ylanilino)-5-[3-(trifluoromethyl)pyrazol-1-yl]pyrazine-2-carboxamide.
| Compound Name | 3-(4-piperidin-4-ylanilino)-5-[3-(trifluoromethyl)pyrazol-1-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 146558901 |
| Molecular Formula | C20H20F3N7O |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 3-(4-piperidin-4-ylanilino)-5-[3-(trifluoromethyl)pyrazol-1-yl]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1ncc(-n2ccc(C(F)(F)F)n2)nc1Nc1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C20H20F3N7O/c21-20(22,23)15-7-10-30(29-15)16-11-26-17(18(24)31)19(28-16)27-14-3-1-12(2-4-14)13-5-8-25-9-6-13/h1-4,7,10-11,13,25H,5-6,8-9H2,(H2,24,31)(H,27,28) |
| InChIKey | RCRMPNGZHHPWMQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |