C27H30N2O4 — CID 129159266
[(1R,9R,10S)-18-benzyl-12-imino-4-methoxy-13-oxo-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-trien-10-yl] acetate (PubChem CID 129159266) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is [(1R,9R,10S)-18-benzyl-12-imino-4-methoxy-13-oxo-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-trien-10-yl] acetate.
| Compound Name | [(1R,9R,10S)-18-benzyl-12-imino-4-methoxy-13-oxo-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-trien-10-yl] acetate |
|---|---|
| PubChem CID | 129159266 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | [(1R,9R,10S)-18-benzyl-12-imino-4-methoxy-13-oxo-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-trien-10-yl] acetate |
| SMILES | [H]/N=C1/C[C@@]2(OC(C)=O)[C@H]3Cc4ccc(OC)cc4[C@@]2(CCCN3Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C27H30N2O4/c1-18(30)33-27-15-23(28)24(31)16-26(27)11-6-12-29(17-19-7-4-3-5-8-19)25(27)13-20-9-10-21(32-2)14-22(20)26/h3-5,7-10,14,25,28H,6,11-13,15-17H2,1-2H3/b28-23-/t25-,26-,27-/m1/s1 |
| InChIKey | QYNHSWBCSSVKBF-ZAUUVWMDSA-N |
| XLogP | 3.84 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|