C29H35NO3 — CID 146601874
(1R,9R,10S,12S,13S)-18-(cyclopropylmethyl)-4-methoxy-12-phenylmethoxy-19-oxa-18-azapentacyclo[7.5.4.110,13.01,10.02,7]nonadeca-2(7),3,5-triene (PubChem CID 146601874) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is (1R,9R,10S,12S,13S)-18-(cyclopropylmethyl)-4-methoxy-12-phenylmethoxy-19-oxa-18-azapentacyclo[7.5.4.110,13.01,10.02,7]nonadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,10S,12S,13S)-18-(cyclopropylmethyl)-4-methoxy-12-phenylmethoxy-19-oxa-18-azapentacyclo[7.5.4.110,13.01,10.02,7]nonadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 146601874 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | (1R,9R,10S,12S,13S)-18-(cyclopropylmethyl)-4-methoxy-12-phenylmethoxy-19-oxa-18-azapentacyclo[7.5.4.110,13.01,10.02,7]nonadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@]13CCCN(CC4CC4)[C@H](C2)[C@]12C[C@H](OCc1ccccc1)[C@H](C3)O2 |
| InChI | InChI=1S/C29H35NO3/c1-31-23-11-10-22-14-27-29-17-25(32-19-21-6-3-2-4-7-21)26(33-29)16-28(29,24(22)15-23)12-5-13-30(27)18-20-8-9-20/h2-4,6-7,10-11,15,20,25-27H,5,8-9,12-14,16-19H2,1H3/t25-,26-,27+,28+,29+/m0/s1 |
| InChIKey | DLYCBERXGNIMOV-MUPNWXRXSA-N |
| XLogP | 4.88 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |