C27H34N2O2 — CID 126497235
(1R,9R)-N-benzyl-17-(cyclopropylmethyl)-4-methoxy-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-amine (PubChem CID 126497235) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is (1R,9R)-N-benzyl-17-(cyclopropylmethyl)-4-methoxy-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-amine.
| Compound Name | (1R,9R)-N-benzyl-17-(cyclopropylmethyl)-4-methoxy-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-amine |
|---|---|
| PubChem CID | 126497235 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (1R,9R)-N-benzyl-17-(cyclopropylmethyl)-4-methoxy-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-amine |
| SMILES | COc1ccc2c(c1)[C@]13CCN(CC4CC4)[C@H](C2)C1OCC(NCc1ccccc1)C3 |
| InChI | InChI=1S/C27H34N2O2/c1-30-23-10-9-21-13-25-26-27(24(21)14-23,11-12-29(25)17-20-7-8-20)15-22(18-31-26)28-16-19-5-3-2-4-6-19/h2-6,9-10,14,20,22,25-26,28H,7-8,11-13,15-18H2,1H3/t22?,25-,26?,27-/m1/s1 |
| InChIKey | ORAKTEJQAKWPSB-VWANLDOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |