C33H44N2O2 — CID 123389836
18-(cyclopropylmethyl)-N-(2-ethenylpenta-2,4-dienyl)-4-methoxy-N-(2-methylidenebut-3-enyl)-11-oxa-18-azatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-14-amine (PubChem CID 123389836) has the molecular formula C33H44N2O2 and a molecular weight of 500.73 g/mol. Its IUPAC name is 18-(cyclopropylmethyl)-N-(2-ethenylpenta-2,4-dienyl)-4-methoxy-N-(2-methylidenebut-3-enyl)-11-oxa-18-azatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-14-amine.
| Compound Name | 18-(cyclopropylmethyl)-N-(2-ethenylpenta-2,4-dienyl)-4-methoxy-N-(2-methylidenebut-3-enyl)-11-oxa-18-azatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-14-amine |
|---|---|
| PubChem CID | 123389836 |
| Molecular Formula | C33H44N2O2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | 18-(cyclopropylmethyl)-N-(2-ethenylpenta-2,4-dienyl)-4-methoxy-N-(2-methylidenebut-3-enyl)-11-oxa-18-azatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-trien-14-amine |
| SMILES | C=CC=C(C=C)CN(CC(=C)C=C)C1CCOC2C3Cc4ccc(OC)cc4C2(CCN3CC2CC2)C1 |
| InChI | InChI=1S/C33H44N2O2/c1-6-9-25(8-3)22-35(21-24(4)7-2)28-14-17-37-32-31-18-27-12-13-29(36-5)19-30(27)33(32,20-28)15-16-34(31)23-26-10-11-26/h6-9,12-13,19,26,28,31-32H,1-4,10-11,14-18,20-23H2,5H3 |
| InChIKey | FHNYCIRYIFHWGL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|