C18H24O6S3 — CID 129159657
tris(3-sulfanylpropyl) benzene-1,3,5-tricarboxylate (PubChem CID 129159657) has the molecular formula C18H24O6S3 and a molecular weight of 432.59 g/mol. Its IUPAC name is tris(3-sulfanylpropyl) benzene-1,3,5-tricarboxylate.
| Compound Name | tris(3-sulfanylpropyl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 129159657 |
| Molecular Formula | C18H24O6S3 |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | tris(3-sulfanylpropyl) benzene-1,3,5-tricarboxylate |
| SMILES | O=C(OCCCS)c1cc(C(=O)OCCCS)cc(C(=O)OCCCS)c1 |
| InChI | InChI=1S/C18H24O6S3/c19-16(22-4-1-7-25)13-10-14(17(20)23-5-2-8-26)12-15(11-13)18(21)24-6-3-9-27/h10-12,25-27H,1-9H2 |
| InChIKey | BWBMOKDPLKGCCG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|