C33H48Br6O6 — CID 87772934
tris(7,8-dibromooctyl) benzene-1,3,5-tricarboxylate (PubChem CID 87772934) has the molecular formula C33H48Br6O6 and a molecular weight of 1020.16 g/mol. Its IUPAC name is tris(7,8-dibromooctyl) benzene-1,3,5-tricarboxylate.
| Compound Name | tris(7,8-dibromooctyl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 87772934 |
| Molecular Formula | C33H48Br6O6 |
| Molecular Weight | 1020.16 g/mol |
| Exact Mass | 1013.86 |
| IUPAC Name | tris(7,8-dibromooctyl) benzene-1,3,5-tricarboxylate |
| SMILES | O=C(OCCCCCCC(Br)CBr)c1cc(C(=O)OCCCCCCC(Br)CBr)cc(C(=O)OCCCCCCC(Br)CBr)c1 |
| InChI | InChI=1S/C33H48Br6O6/c34-22-28(37)13-7-1-4-10-16-43-31(40)25-19-26(32(41)44-17-11-5-2-8-14-29(38)23-35)21-27(20-25)33(42)45-18-12-6-3-9-15-30(39)24-36/h19-21,28-30H,1-18,22-24H2 |
| InChIKey | FPHABSYCGYUCOX-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.16 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|