C20H18FNO2S — CID 129160685
[4-(4-fluorophenyl)-1-benzothiophen-2-yl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 129160685) has the molecular formula C20H18FNO2S and a molecular weight of 355.43 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-1-benzothiophen-2-yl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [4-(4-fluorophenyl)-1-benzothiophen-2-yl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 129160685 |
| Molecular Formula | C20H18FNO2S |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [4-(4-fluorophenyl)-1-benzothiophen-2-yl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1cc2c(-c3ccc(F)cc3)cccc2s1)N1CCC(O)CC1 |
| InChI | InChI=1S/C20H18FNO2S/c21-14-6-4-13(5-7-14)16-2-1-3-18-17(16)12-19(25-18)20(24)22-10-8-15(23)9-11-22/h1-7,12,15,23H,8-11H2 |
| InChIKey | CLSQMXLQNDQIEP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |