C12H14IN3OS — CID 129163372
4-(3-iodo-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)-3-methylmorpholine (PubChem CID 129163372) has the molecular formula C12H14IN3OS and a molecular weight of 375.24 g/mol. Its IUPAC name is 4-(3-iodo-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)-3-methylmorpholine.
| Compound Name | 4-(3-iodo-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)-3-methylmorpholine |
|---|---|
| PubChem CID | 129163372 |
| Molecular Formula | C12H14IN3OS |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 4-(3-iodo-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)-3-methylmorpholine |
| SMILES | CC1COCCN1c1cnc2c(c1)c(I)cn2S |
| InChI | InChI=1S/C12H14IN3OS/c1-8-7-17-3-2-15(8)9-4-10-11(13)6-16(18)12(10)14-5-9/h4-6,8,18H,2-3,7H2,1H3 |
| InChIKey | ANYOBESVPMDJIA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|