C6H11NO — CID 129167820
(2Z,4Z)-2-aminohexa-2,4-dien-3-ol (PubChem CID 129167820) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (2Z,4Z)-2-aminohexa-2,4-dien-3-ol.
| Compound Name | (2Z,4Z)-2-aminohexa-2,4-dien-3-ol |
|---|---|
| PubChem CID | 129167820 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (2Z,4Z)-2-aminohexa-2,4-dien-3-ol |
| SMILES | C/C=C\C(O)=C(/C)N |
| InChI | InChI=1S/C6H11NO/c1-3-4-6(8)5(2)7/h3-4,8H,7H2,1-2H3/b4-3-,6-5- |
| InChIKey | LYWSHSGNGASEKJ-OUPQRBNQSA-N |
| XLogP | 1.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|